About 4-(thiatriazol-5-yl)-1,3-oxazole
4-(thiatriazol-5-yl)-1,3-oxazole (PubChem CID 54566276) has the molecular formula C4H2N4OS
and a molecular weight of 154.15 g/mol. Its IUPAC name is 4-(thiatriazol-5-yl)-1,3-oxazole.
Molecular Properties
| Compound Name | 4-(thiatriazol-5-yl)-1,3-oxazole |
| PubChem CID | 54566276 |
| Molecular Formula | C4H2N4OS |
| Molecular Weight | 154.15 g/mol |
| Exact Mass | 153.99 |
| IUPAC Name | 4-(thiatriazol-5-yl)-1,3-oxazole |
| SMILES | c1nc(-c2nnns2)co1 |
| InChI | InChI=1S/C4H2N4OS/c1-3(5-2-9-1)4-6-7-8-10-4/h1-2H |
| InChIKey | TYEQAKDVAXMQPQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.15 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(thiatriazol-5-yl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(thiatriazol-5-yl)-1,3-oxazole?
The IUPAC name of 4-(thiatriazol-5-yl)-1,3-oxazole (CID 54566276) is 4-(thiatriazol-5-yl)-1,3-oxazole.
What is the SMILES notation for 4-(thiatriazol-5-yl)-1,3-oxazole?
The canonical SMILES for 4-(thiatriazol-5-yl)-1,3-oxazole is c1nc(-c2nnns2)co1.
What is the InChIKey of 4-(thiatriazol-5-yl)-1,3-oxazole?
The InChIKey is TYEQAKDVAXMQPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2N4OS/c1-3(5-2-9-1)4-6-7-8-10-4/h1-2H.
What are the key properties of 4-(thiatriazol-5-yl)-1,3-oxazole?
4-(thiatriazol-5-yl)-1,3-oxazole has a molecular weight of 154.15 g/mol, XLogP of 0.59, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(thiatriazol-5-yl)-1,3-oxazole is sourced from PubChem (CID 54566276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).