About 1-benzofuran-2-yl-(2,4-difluorophenyl)-pyrimidin-5-ylmethanol
1-benzofuran-2-yl-(2,4-difluorophenyl)-pyrimidin-5-ylmethanol (PubChem CID 54566305) has the molecular formula C19H12F2N2O2
and a molecular weight of 338.31 g/mol. Its IUPAC name is 1-benzofuran-2-yl-(2,4-difluorophenyl)-pyrimidin-5-ylmethanol.
Molecular Properties
| Compound Name | 1-benzofuran-2-yl-(2,4-difluorophenyl)-pyrimidin-5-ylmethanol |
| PubChem CID | 54566305 |
| Molecular Formula | C19H12F2N2O2 |
| Molecular Weight | 338.31 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1-benzofuran-2-yl-(2,4-difluorophenyl)-pyrimidin-5-ylmethanol |
| SMILES | OC(c1cncnc1)(c1cc2ccccc2o1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H12F2N2O2/c20-14-5-6-15(16(21)8-14)19(24,13-9-22-11-23-10-13)18-7-12-3-1-2-4-17(12)25-18/h1-11,24H |
| InChIKey | ZUBFROCDMSEKIX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.31 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzofuran-2-yl-(2,4-difluorophenyl)-pyrimidin-5-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-2-yl-(2,4-difluorophenyl)-pyrimidin-5-ylmethanol?
The IUPAC name of 1-benzofuran-2-yl-(2,4-difluorophenyl)-pyrimidin-5-ylmethanol (CID 54566305) is 1-benzofuran-2-yl-(2,4-difluorophenyl)-pyrimidin-5-ylmethanol.
What is the SMILES notation for 1-benzofuran-2-yl-(2,4-difluorophenyl)-pyrimidin-5-ylmethanol?
The canonical SMILES for 1-benzofuran-2-yl-(2,4-difluorophenyl)-pyrimidin-5-ylmethanol is OC(c1cncnc1)(c1cc2ccccc2o1)c1ccc(F)cc1F.
What is the InChIKey of 1-benzofuran-2-yl-(2,4-difluorophenyl)-pyrimidin-5-ylmethanol?
The InChIKey is ZUBFROCDMSEKIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F2N2O2/c20-14-5-6-15(16(21)8-14)19(24,13-9-22-11-23-10-13)18-7-12-3-1-2-4-17(12)25-18/h1-11,24H.
What are the key properties of 1-benzofuran-2-yl-(2,4-difluorophenyl)-pyrimidin-5-ylmethanol?
1-benzofuran-2-yl-(2,4-difluorophenyl)-pyrimidin-5-ylmethanol has a molecular weight of 338.31 g/mol, XLogP of 3.79, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-2-yl-(2,4-difluorophenyl)-pyrimidin-5-ylmethanol is sourced from PubChem (CID 54566305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).