C20H30N2O5 — CID 54566343
(2S)-4-methyl-2-[2-[2-oxo-2-(phenylmethoxyamino)ethyl]pentanoylamino]pentanoic acid (PubChem CID 54566343) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is (2S)-4-methyl-2-[2-[2-oxo-2-(phenylmethoxyamino)ethyl]pentanoylamino]pentanoic acid.
| Compound Name | (2S)-4-methyl-2-[2-[2-oxo-2-(phenylmethoxyamino)ethyl]pentanoylamino]pentanoic acid |
|---|---|
| PubChem CID | 54566343 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (2S)-4-methyl-2-[2-[2-oxo-2-(phenylmethoxyamino)ethyl]pentanoylamino]pentanoic acid |
| SMILES | CCCC(CC(=O)NOCc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C20H30N2O5/c1-4-8-16(19(24)21-17(20(25)26)11-14(2)3)12-18(23)22-27-13-15-9-6-5-7-10-15/h5-7,9-10,14,16-17H,4,8,11-13H2,1-3H3,(H,21,24)(H,22,23)(H,25,26)/t16?,17-/m0/s1 |
| InChIKey | ZUCALAMVFLUSFC-DJNXLDHESA-N |
| XLogP | 2.66 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|