C44H32N4O4 — CID 54566491
3-[10,15,20-tris(3-hydroxyphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenol (PubChem CID 54566491) has the molecular formula C44H32N4O4 and a molecular weight of 680.76 g/mol. Its IUPAC name is 3-[10,15,20-tris(3-hydroxyphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenol.
| Compound Name | 3-[10,15,20-tris(3-hydroxyphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenol |
|---|---|
| PubChem CID | 54566491 |
| Molecular Formula | C44H32N4O4 |
| Molecular Weight | 680.76 g/mol |
| Exact Mass | 680.24 |
| IUPAC Name | 3-[10,15,20-tris(3-hydroxyphenyl)-21,22,23,24-tetrahydroporphyrin-5-yl]phenol |
| SMILES | Oc1cccc(C2=c3ccc([nH]3)=C(c3cccc(O)c3)c3ccc([nH]3)C(c3cccc(O)c3)=c3ccc([nH]3)=C(c3cccc(O)c3)c3ccc2[nH]3)c1 |
| InChI | InChI=1S/C44H32N4O4/c49-29-9-1-5-25(21-29)41-33-13-15-35(45-33)42(26-6-2-10-30(50)22-26)37-17-19-39(47-37)44(28-8-4-12-32(52)24-28)40-20-18-38(48-40)43(36-16-14-34(41)46-36)27-7-3-11-31(51)23-27/h1-24,45-52H |
| InChIKey | HCNNZWKIHZUMHS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 144.08 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.76 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 4 |