C12H22O4S — CID 545667
(5-acetylsulfanyl-3-hydroxypentyl) 2,2-dimethylpropanoate (PubChem CID 545667) has the molecular formula C12H22O4S and a molecular weight of 262.37 g/mol. Its IUPAC name is (5-acetylsulfanyl-3-hydroxypentyl) 2,2-dimethylpropanoate.
| Compound Name | (5-acetylsulfanyl-3-hydroxypentyl) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 545667 |
| Molecular Formula | C12H22O4S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (5-acetylsulfanyl-3-hydroxypentyl) 2,2-dimethylpropanoate |
| SMILES | CC(=O)SCCC(O)CCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H22O4S/c1-9(13)17-8-6-10(14)5-7-16-11(15)12(2,3)4/h10,14H,5-8H2,1-4H3 |
| InChIKey | LTDROGUFMKUICV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|