About N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide
N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide (PubChem CID 54567133) has the molecular formula C12H14N4O
and a molecular weight of 230.27 g/mol. Its IUPAC name is N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide.
Molecular Properties
| Compound Name | N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide |
| PubChem CID | 54567133 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide |
| SMILES | [H]/N=C(\N)N(C)C(=O)c1cc2c(C)cccc2[nH]1 |
| InChI | InChI=1S/C12H14N4O/c1-7-4-3-5-9-8(7)6-10(15-9)11(17)16(2)12(13)14/h3-6,15H,1-2H3,(H3,13,14) |
| InChIKey | ZUQJLAVZDZMWHM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide?
The IUPAC name of N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide (CID 54567133) is N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide.
What is the SMILES notation for N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide?
The canonical SMILES for N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide is [H]/N=C(\N)N(C)C(=O)c1cc2c(C)cccc2[nH]1.
What is the InChIKey of N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide?
The InChIKey is ZUQJLAVZDZMWHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O/c1-7-4-3-5-9-8(7)6-10(15-9)11(17)16(2)12(13)14/h3-6,15H,1-2H3,(H3,13,14).
What are the key properties of N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide?
N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide has a molecular weight of 230.27 g/mol, XLogP of 1.44, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-carbamimidoyl-N,4-dimethyl-1H-indole-2-carboxamide is sourced from PubChem (CID 54567133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).