About 5,6-diethyl-N,N-dimethylcyclohex-3-en-1-amine
5,6-diethyl-N,N-dimethylcyclohex-3-en-1-amine (PubChem CID 54568279) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is 5,6-diethyl-N,N-dimethylcyclohex-3-en-1-amine.
Molecular Properties
| Compound Name | 5,6-diethyl-N,N-dimethylcyclohex-3-en-1-amine |
| PubChem CID | 54568279 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 5,6-diethyl-N,N-dimethylcyclohex-3-en-1-amine |
| SMILES | CCC1C=CCC(N(C)C)C1CC |
| InChI | InChI=1S/C12H23N/c1-5-10-8-7-9-12(13(3)4)11(10)6-2/h7-8,10-12H,5-6,9H2,1-4H3 |
| InChIKey | ZVKDCRKHROWGST-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,6-diethyl-N,N-dimethylcyclohex-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diethyl-N,N-dimethylcyclohex-3-en-1-amine?
The IUPAC name of 5,6-diethyl-N,N-dimethylcyclohex-3-en-1-amine (CID 54568279) is 5,6-diethyl-N,N-dimethylcyclohex-3-en-1-amine.
What is the SMILES notation for 5,6-diethyl-N,N-dimethylcyclohex-3-en-1-amine?
The canonical SMILES for 5,6-diethyl-N,N-dimethylcyclohex-3-en-1-amine is CCC1C=CCC(N(C)C)C1CC.
What is the InChIKey of 5,6-diethyl-N,N-dimethylcyclohex-3-en-1-amine?
The InChIKey is ZVKDCRKHROWGST-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N/c1-5-10-8-7-9-12(13(3)4)11(10)6-2/h7-8,10-12H,5-6,9H2,1-4H3.
What are the key properties of 5,6-diethyl-N,N-dimethylcyclohex-3-en-1-amine?
5,6-diethyl-N,N-dimethylcyclohex-3-en-1-amine has a molecular weight of 181.32 g/mol, XLogP of 2.93, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diethyl-N,N-dimethylcyclohex-3-en-1-amine is sourced from PubChem (CID 54568279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).