About N'-(3,3-dimethylbutan-2-yl)-3-ethyl-2-methylbutanediamide
N'-(3,3-dimethylbutan-2-yl)-3-ethyl-2-methylbutanediamide (PubChem CID 54568560) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is N'-(3,3-dimethylbutan-2-yl)-3-ethyl-2-methylbutanediamide.
Molecular Properties
| Compound Name | N'-(3,3-dimethylbutan-2-yl)-3-ethyl-2-methylbutanediamide |
| PubChem CID | 54568560 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | N'-(3,3-dimethylbutan-2-yl)-3-ethyl-2-methylbutanediamide |
| SMILES | CCC(C(=O)NC(C)C(C)(C)C)C(C)C(N)=O |
| InChI | InChI=1S/C13H26N2O2/c1-7-10(8(2)11(14)16)12(17)15-9(3)13(4,5)6/h8-10H,7H2,1-6H3,(H2,14,16)(H,15,17) |
| InChIKey | ZVOUJQYFGUEUNV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N'-(3,3-dimethylbutan-2-yl)-3-ethyl-2-methylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3,3-dimethylbutan-2-yl)-3-ethyl-2-methylbutanediamide?
The IUPAC name of N'-(3,3-dimethylbutan-2-yl)-3-ethyl-2-methylbutanediamide (CID 54568560) is N'-(3,3-dimethylbutan-2-yl)-3-ethyl-2-methylbutanediamide.
What is the SMILES notation for N'-(3,3-dimethylbutan-2-yl)-3-ethyl-2-methylbutanediamide?
The canonical SMILES for N'-(3,3-dimethylbutan-2-yl)-3-ethyl-2-methylbutanediamide is CCC(C(=O)NC(C)C(C)(C)C)C(C)C(N)=O.
What is the InChIKey of N'-(3,3-dimethylbutan-2-yl)-3-ethyl-2-methylbutanediamide?
The InChIKey is ZVOUJQYFGUEUNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O2/c1-7-10(8(2)11(14)16)12(17)15-9(3)13(4,5)6/h8-10H,7H2,1-6H3,(H2,14,16)(H,15,17).
What are the key properties of N'-(3,3-dimethylbutan-2-yl)-3-ethyl-2-methylbutanediamide?
N'-(3,3-dimethylbutan-2-yl)-3-ethyl-2-methylbutanediamide has a molecular weight of 242.36 g/mol, XLogP of 1.68, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3,3-dimethylbutan-2-yl)-3-ethyl-2-methylbutanediamide is sourced from PubChem (CID 54568560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).