About 3-(methylsulfanylmethyl)-2-oxo-1,3-thiazole-4-carboxamide
3-(methylsulfanylmethyl)-2-oxo-1,3-thiazole-4-carboxamide (PubChem CID 54568924) has the molecular formula C6H8N2O2S2
and a molecular weight of 204.28 g/mol. Its IUPAC name is 3-(methylsulfanylmethyl)-2-oxo-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-(methylsulfanylmethyl)-2-oxo-1,3-thiazole-4-carboxamide |
| PubChem CID | 54568924 |
| Molecular Formula | C6H8N2O2S2 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | 3-(methylsulfanylmethyl)-2-oxo-1,3-thiazole-4-carboxamide |
| SMILES | CSCn1c(C(N)=O)csc1=O |
| InChI | InChI=1S/C6H8N2O2S2/c1-11-3-8-4(5(7)9)2-12-6(8)10/h2H,3H2,1H3,(H2,7,9) |
| InChIKey | ZVVRMBZKRFWYPC-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(methylsulfanylmethyl)-2-oxo-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methylsulfanylmethyl)-2-oxo-1,3-thiazole-4-carboxamide?
The IUPAC name of 3-(methylsulfanylmethyl)-2-oxo-1,3-thiazole-4-carboxamide (CID 54568924) is 3-(methylsulfanylmethyl)-2-oxo-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 3-(methylsulfanylmethyl)-2-oxo-1,3-thiazole-4-carboxamide?
The canonical SMILES for 3-(methylsulfanylmethyl)-2-oxo-1,3-thiazole-4-carboxamide is CSCn1c(C(N)=O)csc1=O.
What is the InChIKey of 3-(methylsulfanylmethyl)-2-oxo-1,3-thiazole-4-carboxamide?
The InChIKey is ZVVRMBZKRFWYPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S2/c1-11-3-8-4(5(7)9)2-12-6(8)10/h2H,3H2,1H3,(H2,7,9).
What are the key properties of 3-(methylsulfanylmethyl)-2-oxo-1,3-thiazole-4-carboxamide?
3-(methylsulfanylmethyl)-2-oxo-1,3-thiazole-4-carboxamide has a molecular weight of 204.28 g/mol, XLogP of 0.33, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methylsulfanylmethyl)-2-oxo-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 54568924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).