About 1H-pyrazole-3,5-dicarboxamide
1H-pyrazole-3,5-dicarboxamide (PubChem CID 54569038) has the molecular formula C5H6N4O2
and a molecular weight of 154.13 g/mol. Its IUPAC name is 1H-pyrazole-3,5-dicarboxamide.
Molecular Properties
| Compound Name | 1H-pyrazole-3,5-dicarboxamide |
| PubChem CID | 54569038 |
| Molecular Formula | C5H6N4O2 |
| Molecular Weight | 154.13 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 1H-pyrazole-3,5-dicarboxamide |
| SMILES | NC(=O)c1cc(C(N)=O)[nH]n1 |
| InChI | InChI=1S/C5H6N4O2/c6-4(10)2-1-3(5(7)11)9-8-2/h1H,(H2,6,10)(H2,7,11)(H,8,9) |
| InChIKey | ZVXTUAKXYXKULZ-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 114.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.13 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrazole-3,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazole-3,5-dicarboxamide?
The IUPAC name of 1H-pyrazole-3,5-dicarboxamide (CID 54569038) is 1H-pyrazole-3,5-dicarboxamide.
What is the SMILES notation for 1H-pyrazole-3,5-dicarboxamide?
The canonical SMILES for 1H-pyrazole-3,5-dicarboxamide is NC(=O)c1cc(C(N)=O)[nH]n1.
What is the InChIKey of 1H-pyrazole-3,5-dicarboxamide?
The InChIKey is ZVXTUAKXYXKULZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4O2/c6-4(10)2-1-3(5(7)11)9-8-2/h1H,(H2,6,10)(H2,7,11)(H,8,9).
What are the key properties of 1H-pyrazole-3,5-dicarboxamide?
1H-pyrazole-3,5-dicarboxamide has a molecular weight of 154.13 g/mol, XLogP of -1.39, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazole-3,5-dicarboxamide is sourced from PubChem (CID 54569038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).