C25H33FN2O3 — CID 54569452
[1-[5-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)pentyl]piperidin-4-yl]-(4-fluorophenyl)methanone (PubChem CID 54569452) has the molecular formula C25H33FN2O3 and a molecular weight of 428.55 g/mol. Its IUPAC name is [1-[5-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)pentyl]piperidin-4-yl]-(4-fluorophenyl)methanone.
| Compound Name | [1-[5-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)pentyl]piperidin-4-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 54569452 |
| Molecular Formula | C25H33FN2O3 |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | [1-[5-(1,3-dihydroxy-4,5,6,7-tetrahydroisoindol-2-yl)pentyl]piperidin-4-yl]-(4-fluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)cc1)C1CCN(CCCCCn2c(O)c3c(c2O)CCCC3)CC1 |
| InChI | InChI=1S/C25H33FN2O3/c26-20-10-8-18(9-11-20)23(29)19-12-16-27(17-13-19)14-4-1-5-15-28-24(30)21-6-2-3-7-22(21)25(28)31/h8-11,19,30-31H,1-7,12-17H2 |
| InChIKey | ZWEWXIGDJMGEER-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 65.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|