About 1-propan-2-yloxyocta-1,3-diene
1-propan-2-yloxyocta-1,3-diene (PubChem CID 54569500) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-propan-2-yloxyocta-1,3-diene.
Molecular Properties
| Compound Name | 1-propan-2-yloxyocta-1,3-diene |
| PubChem CID | 54569500 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 1-propan-2-yloxyocta-1,3-diene |
| SMILES | CCCCC=CC=COC(C)C |
| InChI | InChI=1S/C11H20O/c1-4-5-6-7-8-9-10-12-11(2)3/h7-11H,4-6H2,1-3H3 |
| InChIKey | ZWFWVEVOUQVLML-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-propan-2-yloxyocta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-yloxyocta-1,3-diene?
The IUPAC name of 1-propan-2-yloxyocta-1,3-diene (CID 54569500) is 1-propan-2-yloxyocta-1,3-diene.
What is the SMILES notation for 1-propan-2-yloxyocta-1,3-diene?
The canonical SMILES for 1-propan-2-yloxyocta-1,3-diene is CCCCC=CC=COC(C)C.
What is the InChIKey of 1-propan-2-yloxyocta-1,3-diene?
The InChIKey is ZWFWVEVOUQVLML-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O/c1-4-5-6-7-8-9-10-12-11(2)3/h7-11H,4-6H2,1-3H3.
What are the key properties of 1-propan-2-yloxyocta-1,3-diene?
1-propan-2-yloxyocta-1,3-diene has a molecular weight of 168.28 g/mol, XLogP of 3.67, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-yloxyocta-1,3-diene is sourced from PubChem (CID 54569500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).