C21H30N2 — CID 54569560
phenyl-(2,3,4,5-tetraethylphenyl)methanediamine (PubChem CID 54569560) has the molecular formula C21H30N2 and a molecular weight of 310.48 g/mol. Its IUPAC name is phenyl-(2,3,4,5-tetraethylphenyl)methanediamine.
| Compound Name | phenyl-(2,3,4,5-tetraethylphenyl)methanediamine |
|---|---|
| PubChem CID | 54569560 |
| Molecular Formula | C21H30N2 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.24 |
| IUPAC Name | phenyl-(2,3,4,5-tetraethylphenyl)methanediamine |
| SMILES | CCc1cc(C(N)(N)c2ccccc2)c(CC)c(CC)c1CC |
| InChI | InChI=1S/C21H30N2/c1-5-15-14-20(19(8-4)18(7-3)17(15)6-2)21(22,23)16-12-10-9-11-13-16/h9-14H,5-8,22-23H2,1-4H3 |
| InChIKey | ZWGWPHTUOWMLHG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|