About 1-ethylpyrrole-2,3,5-triol
1-ethylpyrrole-2,3,5-triol (PubChem CID 54569657) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is 1-ethylpyrrole-2,3,5-triol.
Molecular Properties
| Compound Name | 1-ethylpyrrole-2,3,5-triol |
| PubChem CID | 54569657 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 1-ethylpyrrole-2,3,5-triol |
| SMILES | CCn1c(O)cc(O)c1O |
| InChI | InChI=1S/C6H9NO3/c1-2-7-5(9)3-4(8)6(7)10/h3,8-10H,2H2,1H3 |
| InChIKey | ZWIIRIRRQQYJSS-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-ethylpyrrole-2,3,5-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpyrrole-2,3,5-triol?
The IUPAC name of 1-ethylpyrrole-2,3,5-triol (CID 54569657) is 1-ethylpyrrole-2,3,5-triol.
What is the SMILES notation for 1-ethylpyrrole-2,3,5-triol?
The canonical SMILES for 1-ethylpyrrole-2,3,5-triol is CCn1c(O)cc(O)c1O.
What is the InChIKey of 1-ethylpyrrole-2,3,5-triol?
The InChIKey is ZWIIRIRRQQYJSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO3/c1-2-7-5(9)3-4(8)6(7)10/h3,8-10H,2H2,1H3.
What are the key properties of 1-ethylpyrrole-2,3,5-triol?
1-ethylpyrrole-2,3,5-triol has a molecular weight of 143.14 g/mol, XLogP of 0.62, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpyrrole-2,3,5-triol is sourced from PubChem (CID 54569657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).