C13H16N2O3 — CID 5456975
[(Z)-(5-methoxy-2,3-dihydroinden-1-ylidene)amino] N,N-dimethylcarbamate (PubChem CID 5456975) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is [(Z)-(5-methoxy-2,3-dihydroinden-1-ylidene)amino] N,N-dimethylcarbamate.
| Compound Name | [(Z)-(5-methoxy-2,3-dihydroinden-1-ylidene)amino] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 5456975 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | [(Z)-(5-methoxy-2,3-dihydroinden-1-ylidene)amino] N,N-dimethylcarbamate |
| SMILES | COc1ccc2c(c1)CC/C2=N/OC(=O)N(C)C |
| InChI | InChI=1S/C13H16N2O3/c1-15(2)13(16)18-14-12-7-4-9-8-10(17-3)5-6-11(9)12/h5-6,8H,4,7H2,1-3H3/b14-12- |
| InChIKey | AEMGCEOYGMLJBQ-OWBHPGMISA-N |
| XLogP | 2.04 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|