About 3-[(3-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-5,5-dimethyloxolan-2-one
3-[(3-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-5,5-dimethyloxolan-2-one (PubChem CID 54569791) has the molecular formula C20H19FO4S
and a molecular weight of 374.43 g/mol. Its IUPAC name is 3-[(3-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-5,5-dimethyloxolan-2-one.
Molecular Properties
| Compound Name | 3-[(3-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-5,5-dimethyloxolan-2-one |
| PubChem CID | 54569791 |
| Molecular Formula | C20H19FO4S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 3-[(3-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-5,5-dimethyloxolan-2-one |
| SMILES | CC1(C)CC(=C(c2ccc(S(C)(=O)=O)cc2)c2cccc(F)c2)C(=O)O1 |
| InChI | InChI=1S/C20H19FO4S/c1-20(2)12-17(19(22)25-20)18(14-5-4-6-15(21)11-14)13-7-9-16(10-8-13)26(3,23)24/h4-11H,12H2,1-3H3 |
| InChIKey | ZWKUALBKXJXVRT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-5,5-dimethyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-5,5-dimethyloxolan-2-one?
The IUPAC name of 3-[(3-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-5,5-dimethyloxolan-2-one (CID 54569791) is 3-[(3-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-5,5-dimethyloxolan-2-one.
What is the SMILES notation for 3-[(3-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-5,5-dimethyloxolan-2-one?
The canonical SMILES for 3-[(3-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-5,5-dimethyloxolan-2-one is CC1(C)CC(=C(c2ccc(S(C)(=O)=O)cc2)c2cccc(F)c2)C(=O)O1.
What is the InChIKey of 3-[(3-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-5,5-dimethyloxolan-2-one?
The InChIKey is ZWKUALBKXJXVRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19FO4S/c1-20(2)12-17(19(22)25-20)18(14-5-4-6-15(21)11-14)13-7-9-16(10-8-13)26(3,23)24/h4-11H,12H2,1-3H3.
What are the key properties of 3-[(3-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-5,5-dimethyloxolan-2-one?
3-[(3-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-5,5-dimethyloxolan-2-one has a molecular weight of 374.43 g/mol, XLogP of 3.76, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-fluorophenyl)-(4-methylsulfonylphenyl)methylidene]-5,5-dimethyloxolan-2-one is sourced from PubChem (CID 54569791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).