C25H37NO4S — CID 54570074
methyl 7-[(1R,2R,3R,5S)-3-hydroxy-5-[(4-methylphenyl)methylsulfanyl]-2-morpholin-4-ylcyclopentyl]hept-5-enoate (PubChem CID 54570074) has the molecular formula C25H37NO4S and a molecular weight of 447.64 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-3-hydroxy-5-[(4-methylphenyl)methylsulfanyl]-2-morpholin-4-ylcyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-3-hydroxy-5-[(4-methylphenyl)methylsulfanyl]-2-morpholin-4-ylcyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 54570074 |
| Molecular Formula | C25H37NO4S |
| Molecular Weight | 447.64 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-3-hydroxy-5-[(4-methylphenyl)methylsulfanyl]-2-morpholin-4-ylcyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCCC=CC[C@@H]1[C@@H](N2CCOCC2)[C@H](O)C[C@@H]1SCc1ccc(C)cc1 |
| InChI | InChI=1S/C25H37NO4S/c1-19-9-11-20(12-10-19)18-31-23-17-22(27)25(26-13-15-30-16-14-26)21(23)7-5-3-4-6-8-24(28)29-2/h3,5,9-12,21-23,25,27H,4,6-8,13-18H2,1-2H3/t21-,22+,23-,25+/m0/s1 |
| InChIKey | ZWPWHAIGQMEGEF-ONTNHIFESA-N |
| XLogP | 3.97 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.64 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|