3-nitro-2-(4-phenylmethoxyanilino)benzoic acid

C20H16N2O5 — CID 54570148

IUPAC3-nitro-2-(4-phenylmethoxyanilino)benzoic acid
SMILESO=C(O)c1cccc([N+](=O)[O-])c1Nc1ccc(OCc2ccccc2)cc1
InChIInChI=1S/C20H16N2O5/c23-20(24)17-7-4-8-18(22(25)26)19(17)21-15-9-11-16(12-10-15)27-13-14-5-2-1-3-6-14/h1-12,21H,13H2,(H,23,24)
InChIKeyZWRHDELUMWWJTI-UHFFFAOYSA-N
MW364.36 g/mol
LogP4.62
Rot. Bonds7

About 3-nitro-2-(4-phenylmethoxyanilino)benzoic acid

3-nitro-2-(4-phenylmethoxyanilino)benzoic acid (PubChem CID 54570148) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is 3-nitro-2-(4-phenylmethoxyanilino)benzoic acid.

Molecular Properties

Compound Name3-nitro-2-(4-phenylmethoxyanilino)benzoic acid
PubChem CID54570148
Molecular FormulaC20H16N2O5
Molecular Weight364.36 g/mol
Exact Mass364.11
IUPAC Name3-nitro-2-(4-phenylmethoxyanilino)benzoic acid
SMILESO=C(O)c1cccc([N+](=O)[O-])c1Nc1ccc(OCc2ccccc2)cc1
InChIInChI=1S/C20H16N2O5/c23-20(24)17-7-4-8-18(22(25)26)19(17)21-15-9-11-16(12-10-15)27-13-14-5-2-1-3-6-14/h1-12,21H,13H2,(H,23,24)
InChIKeyZWRHDELUMWWJTI-UHFFFAOYSA-N
XLogP4.62
TPSA101.70 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms27
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500364.36
LogP ≤ 54.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3-nitro-2-(4-phenylmethoxyanilino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-nitro-2-(4-phenylmethoxyanilino)benzoic acid?
The IUPAC name of 3-nitro-2-(4-phenylmethoxyanilino)benzoic acid (CID 54570148) is 3-nitro-2-(4-phenylmethoxyanilino)benzoic acid.
What is the SMILES notation for 3-nitro-2-(4-phenylmethoxyanilino)benzoic acid?
The canonical SMILES for 3-nitro-2-(4-phenylmethoxyanilino)benzoic acid is O=C(O)c1cccc([N+](=O)[O-])c1Nc1ccc(OCc2ccccc2)cc1.
What is the InChIKey of 3-nitro-2-(4-phenylmethoxyanilino)benzoic acid?
The InChIKey is ZWRHDELUMWWJTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O5/c23-20(24)17-7-4-8-18(22(25)26)19(17)21-15-9-11-16(12-10-15)27-13-14-5-2-1-3-6-14/h1-12,21H,13H2,(H,23,24).
What are the key properties of 3-nitro-2-(4-phenylmethoxyanilino)benzoic acid?
3-nitro-2-(4-phenylmethoxyanilino)benzoic acid has a molecular weight of 364.36 g/mol, XLogP of 4.62, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-2-(4-phenylmethoxyanilino)benzoic acid is sourced from PubChem (CID 54570148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).