About 16-acetyloxyhexadeca-4,12-dienyl acetate
16-acetyloxyhexadeca-4,12-dienyl acetate (PubChem CID 54570942) has the molecular formula C20H34O4
and a molecular weight of 338.49 g/mol. Its IUPAC name is 16-acetyloxyhexadeca-4,12-dienyl acetate.
Molecular Properties
| Compound Name | 16-acetyloxyhexadeca-4,12-dienyl acetate |
| PubChem CID | 54570942 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 16-acetyloxyhexadeca-4,12-dienyl acetate |
| SMILES | CC(=O)OCCCC=CCCCCCCC=CCCCOC(C)=O |
| InChI | InChI=1S/C20H34O4/c1-19(21)23-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-24-20(2)22/h9-12H,3-8,13-18H2,1-2H3 |
| InChIKey | ZXFCLIIUIYRZPN-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 16-acetyloxyhexadeca-4,12-dienyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 16-acetyloxyhexadeca-4,12-dienyl acetate?
The IUPAC name of 16-acetyloxyhexadeca-4,12-dienyl acetate (CID 54570942) is 16-acetyloxyhexadeca-4,12-dienyl acetate.
What is the SMILES notation for 16-acetyloxyhexadeca-4,12-dienyl acetate?
The canonical SMILES for 16-acetyloxyhexadeca-4,12-dienyl acetate is CC(=O)OCCCC=CCCCCCCC=CCCCOC(C)=O.
What is the InChIKey of 16-acetyloxyhexadeca-4,12-dienyl acetate?
The InChIKey is ZXFCLIIUIYRZPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O4/c1-19(21)23-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-24-20(2)22/h9-12H,3-8,13-18H2,1-2H3.
What are the key properties of 16-acetyloxyhexadeca-4,12-dienyl acetate?
16-acetyloxyhexadeca-4,12-dienyl acetate has a molecular weight of 338.49 g/mol, XLogP of 5.13, 15 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 16-acetyloxyhexadeca-4,12-dienyl acetate is sourced from PubChem (CID 54570942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).