C12H20O2 — CID 54570965
10a-hydroxy-1,2,3,4,4a,5,6,8,9,10-decahydrobenzo[8]annulen-7-one (PubChem CID 54570965) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 10a-hydroxy-1,2,3,4,4a,5,6,8,9,10-decahydrobenzo[8]annulen-7-one.
| Compound Name | 10a-hydroxy-1,2,3,4,4a,5,6,8,9,10-decahydrobenzo[8]annulen-7-one |
|---|---|
| PubChem CID | 54570965 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 10a-hydroxy-1,2,3,4,4a,5,6,8,9,10-decahydrobenzo[8]annulen-7-one |
| SMILES | O=C1CCCC2(O)CCCCC2CC1 |
| InChI | InChI=1S/C12H20O2/c13-11-5-3-9-12(14)8-2-1-4-10(12)6-7-11/h10,14H,1-9H2 |
| InChIKey | ZXFMSOYWKLTPGN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |