C30H33NO4S — CID 54571040
3-[3-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl)-5-(2-butoxyphenyl)sulfanyl-1-benzofuran-2-yl]prop-2-ynoic acid (PubChem CID 54571040) has the molecular formula C30H33NO4S and a molecular weight of 503.66 g/mol. Its IUPAC name is 3-[3-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl)-5-(2-butoxyphenyl)sulfanyl-1-benzofuran-2-yl]prop-2-ynoic acid.
| Compound Name | 3-[3-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl)-5-(2-butoxyphenyl)sulfanyl-1-benzofuran-2-yl]prop-2-ynoic acid |
|---|---|
| PubChem CID | 54571040 |
| Molecular Formula | C30H33NO4S |
| Molecular Weight | 503.66 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 3-[3-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-2-yl)-5-(2-butoxyphenyl)sulfanyl-1-benzofuran-2-yl]prop-2-ynoic acid |
| SMILES | CCCCOc1ccccc1Sc1ccc2oc(C#CC(=O)O)c(C3CCN4CCCCC4C3)c2c1 |
| InChI | InChI=1S/C30H33NO4S/c1-2-3-18-34-26-9-4-5-10-28(26)36-23-11-12-25-24(20-23)30(27(35-25)13-14-29(32)33)21-15-17-31-16-7-6-8-22(31)19-21/h4-5,9-12,20-22H,2-3,6-8,15-19H2,1H3,(H,32,33) |
| InChIKey | ZXGQBRHCIKHKJZ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.66 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|