C11H9BrF3N3O — CID 54571696
7-bromo-8-(trifluoromethyl)-3,4-dihydro-1H-[1,4]oxazino[4,3-a]benzimidazol-6-amine (PubChem CID 54571696) has the molecular formula C11H9BrF3N3O and a molecular weight of 336.11 g/mol. Its IUPAC name is 7-bromo-8-(trifluoromethyl)-3,4-dihydro-1H-[1,4]oxazino[4,3-a]benzimidazol-6-amine.
| Compound Name | 7-bromo-8-(trifluoromethyl)-3,4-dihydro-1H-[1,4]oxazino[4,3-a]benzimidazol-6-amine |
|---|---|
| PubChem CID | 54571696 |
| Molecular Formula | C11H9BrF3N3O |
| Molecular Weight | 336.11 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | 7-bromo-8-(trifluoromethyl)-3,4-dihydro-1H-[1,4]oxazino[4,3-a]benzimidazol-6-amine |
| SMILES | Nc1c(Br)c(C(F)(F)F)cc2nc3n(c12)CCOC3 |
| InChI | InChI=1S/C11H9BrF3N3O/c12-8-5(11(13,14)15)3-6-10(9(8)16)18-1-2-19-4-7(18)17-6/h3H,1-2,4,16H2 |
| InChIKey | ZXSWVPYJXDZXSI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.11 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|