C46H36N2O2Si — CID 54571742
2-[2-[5-[2-(1,3-benzoxazol-2-yl)phenyl]-1,1-dimethyl-3,4-bis(3-methylphenyl)silol-2-yl]phenyl]-1,3-benzoxazole (PubChem CID 54571742) has the molecular formula C46H36N2O2Si and a molecular weight of 676.89 g/mol. Its IUPAC name is 2-[2-[5-[2-(1,3-benzoxazol-2-yl)phenyl]-1,1-dimethyl-3,4-bis(3-methylphenyl)silol-2-yl]phenyl]-1,3-benzoxazole.
| Compound Name | 2-[2-[5-[2-(1,3-benzoxazol-2-yl)phenyl]-1,1-dimethyl-3,4-bis(3-methylphenyl)silol-2-yl]phenyl]-1,3-benzoxazole |
|---|---|
| PubChem CID | 54571742 |
| Molecular Formula | C46H36N2O2Si |
| Molecular Weight | 676.89 g/mol |
| Exact Mass | 676.25 |
| IUPAC Name | 2-[2-[5-[2-(1,3-benzoxazol-2-yl)phenyl]-1,1-dimethyl-3,4-bis(3-methylphenyl)silol-2-yl]phenyl]-1,3-benzoxazole |
| SMILES | Cc1cccc(C2=C(c3ccccc3-c3nc4ccccc4o3)[Si](C)(C)C(c3ccccc3-c3nc4ccccc4o3)=C2c2cccc(C)c2)c1 |
| InChI | InChI=1S/C46H36N2O2Si/c1-29-15-13-17-31(27-29)41-42(32-18-14-16-30(2)28-32)44(34-20-6-8-22-36(34)46-48-38-24-10-12-26-40(38)50-46)51(3,4)43(41)33-19-5-7-21-35(33)45-47-37-23-9-11-25-39(37)49-45/h5-28H,1-4H3 |
| InChIKey | ZXTVJOGZEVQXER-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 52.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.89 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|