C18H19N7O2 — CID 5457216
(2S,3Z)-3-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]propane-1,2-diol (PubChem CID 5457216) has the molecular formula C18H19N7O2 and a molecular weight of 365.40 g/mol. Its IUPAC name is (2S,3Z)-3-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]propane-1,2-diol.
| Compound Name | (2S,3Z)-3-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]propane-1,2-diol |
|---|---|
| PubChem CID | 5457216 |
| Molecular Formula | C18H19N7O2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | (2S,3Z)-3-[(4,6-dianilino-1,3,5-triazin-2-yl)hydrazinylidene]propane-1,2-diol |
| SMILES | OC[C@@H](O)/C=N\Nc1nc(Nc2ccccc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C18H19N7O2/c26-12-15(27)11-19-25-18-23-16(20-13-7-3-1-4-8-13)22-17(24-18)21-14-9-5-2-6-10-14/h1-11,15,26-27H,12H2,(H3,20,21,22,23,24,25)/b19-11-/t15-/m0/s1 |
| InChIKey | ZVIWROLUXGGDNS-VUQQOUJSSA-N |
| XLogP | 2.11 |
| TPSA | 127.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|