C9H15N3 — CID 54572211
3-N,3-N-diethylpyridine-2,3-diamine (PubChem CID 54572211) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 3-N,3-N-diethylpyridine-2,3-diamine.
| Compound Name | 3-N,3-N-diethylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 54572211 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 3-N,3-N-diethylpyridine-2,3-diamine |
| SMILES | CCN(CC)c1cccnc1N |
| InChI | InChI=1S/C9H15N3/c1-3-12(4-2)8-6-5-7-11-9(8)10/h5-7H,3-4H2,1-2H3,(H2,10,11) |
| InChIKey | ZYCNWOTUZSATND-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |