About 1,3-bis(2-butoxyethoxy)-2,2-dimethylpropane
1,3-bis(2-butoxyethoxy)-2,2-dimethylpropane (PubChem CID 545723) has the molecular formula C17H36O4
and a molecular weight of 304.47 g/mol. Its IUPAC name is 1,3-bis(2-butoxyethoxy)-2,2-dimethylpropane.
Molecular Properties
| Compound Name | 1,3-bis(2-butoxyethoxy)-2,2-dimethylpropane |
| PubChem CID | 545723 |
| Molecular Formula | C17H36O4 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.26 |
| IUPAC Name | 1,3-bis(2-butoxyethoxy)-2,2-dimethylpropane |
| SMILES | CCCCOCCOCC(C)(C)COCCOCCCC |
| InChI | InChI=1S/C17H36O4/c1-5-7-9-18-11-13-20-15-17(3,4)16-21-14-12-19-10-8-6-2/h5-16H2,1-4H3 |
| InChIKey | AZCNBSCJYIQQMG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(2-butoxyethoxy)-2,2-dimethylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(2-butoxyethoxy)-2,2-dimethylpropane?
The IUPAC name of 1,3-bis(2-butoxyethoxy)-2,2-dimethylpropane (CID 545723) is 1,3-bis(2-butoxyethoxy)-2,2-dimethylpropane.
What is the SMILES notation for 1,3-bis(2-butoxyethoxy)-2,2-dimethylpropane?
The canonical SMILES for 1,3-bis(2-butoxyethoxy)-2,2-dimethylpropane is CCCCOCCOCC(C)(C)COCCOCCCC.
What is the InChIKey of 1,3-bis(2-butoxyethoxy)-2,2-dimethylpropane?
The InChIKey is AZCNBSCJYIQQMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36O4/c1-5-7-9-18-11-13-20-15-17(3,4)16-21-14-12-19-10-8-6-2/h5-16H2,1-4H3.
What are the key properties of 1,3-bis(2-butoxyethoxy)-2,2-dimethylpropane?
1,3-bis(2-butoxyethoxy)-2,2-dimethylpropane has a molecular weight of 304.47 g/mol, XLogP of 3.68, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(2-butoxyethoxy)-2,2-dimethylpropane is sourced from PubChem (CID 545723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).