C36H74N6 — CID 54572545
N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)-4-[[(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]octane-1,8-diamine (PubChem CID 54572545) has the molecular formula C36H74N6 and a molecular weight of 591.03 g/mol. Its IUPAC name is N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)-4-[[(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]octane-1,8-diamine.
| Compound Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)-4-[[(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]octane-1,8-diamine |
|---|---|
| PubChem CID | 54572545 |
| Molecular Formula | C36H74N6 |
| Molecular Weight | 591.03 g/mol |
| Exact Mass | 590.60 |
| IUPAC Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)-4-[[(2,2,6,6-tetramethylpiperidin-4-yl)amino]methyl]octane-1,8-diamine |
| SMILES | CC1(C)CC(NCCCCC(CCCNC2CC(C)(C)NC(C)(C)C2)CNC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C36H74N6/c1-31(2)20-28(21-32(3,4)40-31)37-18-14-13-16-27(26-39-30-24-35(9,10)42-36(11,12)25-30)17-15-19-38-29-22-33(5,6)41-34(7,8)23-29/h27-30,37-42H,13-26H2,1-12H3 |
| InChIKey | ZYIMGCCAZJKSIH-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.03 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|