About 1-[4-(hydroperoxymethyl)phenyl]sulfanyl-N-methylmethanamine;isocyanic acid
1-[4-(hydroperoxymethyl)phenyl]sulfanyl-N-methylmethanamine;isocyanic acid (PubChem CID 54572748) has the molecular formula C10H14N2O3S
and a molecular weight of 242.30 g/mol. Its IUPAC name is 1-[4-(hydroperoxymethyl)phenyl]sulfanyl-N-methylmethanamine;isocyanic acid.
Molecular Properties
| Compound Name | 1-[4-(hydroperoxymethyl)phenyl]sulfanyl-N-methylmethanamine;isocyanic acid |
| PubChem CID | 54572748 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 1-[4-(hydroperoxymethyl)phenyl]sulfanyl-N-methylmethanamine;isocyanic acid |
| SMILES | CNCSc1ccc(COO)cc1.N=C=O |
| InChI | InChI=1S/C9H13NO2S.CHNO/c1-10-7-13-9-4-2-8(3-5-9)6-12-11;2-1-3/h2-5,10-11H,6-7H2,1H3;2H |
| InChIKey | ZYLVVOWPSDIATO-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 82.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(hydroperoxymethyl)phenyl]sulfanyl-N-methylmethanamine;isocyanic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(hydroperoxymethyl)phenyl]sulfanyl-N-methylmethanamine;isocyanic acid?
The IUPAC name of 1-[4-(hydroperoxymethyl)phenyl]sulfanyl-N-methylmethanamine;isocyanic acid (CID 54572748) is 1-[4-(hydroperoxymethyl)phenyl]sulfanyl-N-methylmethanamine;isocyanic acid.
What is the SMILES notation for 1-[4-(hydroperoxymethyl)phenyl]sulfanyl-N-methylmethanamine;isocyanic acid?
The canonical SMILES for 1-[4-(hydroperoxymethyl)phenyl]sulfanyl-N-methylmethanamine;isocyanic acid is CNCSc1ccc(COO)cc1.N=C=O.
What is the InChIKey of 1-[4-(hydroperoxymethyl)phenyl]sulfanyl-N-methylmethanamine;isocyanic acid?
The InChIKey is ZYLVVOWPSDIATO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S.CHNO/c1-10-7-13-9-4-2-8(3-5-9)6-12-11;2-1-3/h2-5,10-11H,6-7H2,1H3;2H.
What are the key properties of 1-[4-(hydroperoxymethyl)phenyl]sulfanyl-N-methylmethanamine;isocyanic acid?
1-[4-(hydroperoxymethyl)phenyl]sulfanyl-N-methylmethanamine;isocyanic acid has a molecular weight of 242.30 g/mol, XLogP of 1.85, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(hydroperoxymethyl)phenyl]sulfanyl-N-methylmethanamine;isocyanic acid is sourced from PubChem (CID 54572748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).