About N'-[2-(diethylamino)ethyl]-N'-(2-diphenylphosphanylethyl)-N,N-diethylethane-1,2-diamine
N'-[2-(diethylamino)ethyl]-N'-(2-diphenylphosphanylethyl)-N,N-diethylethane-1,2-diamine (PubChem CID 54573019) has the molecular formula C26H42N3P
and a molecular weight of 427.62 g/mol. Its IUPAC name is N'-[2-(diethylamino)ethyl]-N'-(2-diphenylphosphanylethyl)-N,N-diethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[2-(diethylamino)ethyl]-N'-(2-diphenylphosphanylethyl)-N,N-diethylethane-1,2-diamine |
| PubChem CID | 54573019 |
| Molecular Formula | C26H42N3P |
| Molecular Weight | 427.62 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | N'-[2-(diethylamino)ethyl]-N'-(2-diphenylphosphanylethyl)-N,N-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCN(CCN(CC)CC)CCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H42N3P/c1-5-27(6-2)19-21-29(22-20-28(7-3)8-4)23-24-30(25-15-11-9-12-16-25)26-17-13-10-14-18-26/h9-18H,5-8,19-24H2,1-4H3 |
| InChIKey | ZYQNFICIECEXQA-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.62 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(diethylamino)ethyl]-N'-(2-diphenylphosphanylethyl)-N,N-diethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(diethylamino)ethyl]-N'-(2-diphenylphosphanylethyl)-N,N-diethylethane-1,2-diamine?
The IUPAC name of N'-[2-(diethylamino)ethyl]-N'-(2-diphenylphosphanylethyl)-N,N-diethylethane-1,2-diamine (CID 54573019) is N'-[2-(diethylamino)ethyl]-N'-(2-diphenylphosphanylethyl)-N,N-diethylethane-1,2-diamine.
What is the SMILES notation for N'-[2-(diethylamino)ethyl]-N'-(2-diphenylphosphanylethyl)-N,N-diethylethane-1,2-diamine?
The canonical SMILES for N'-[2-(diethylamino)ethyl]-N'-(2-diphenylphosphanylethyl)-N,N-diethylethane-1,2-diamine is CCN(CC)CCN(CCN(CC)CC)CCP(c1ccccc1)c1ccccc1.
What is the InChIKey of N'-[2-(diethylamino)ethyl]-N'-(2-diphenylphosphanylethyl)-N,N-diethylethane-1,2-diamine?
The InChIKey is ZYQNFICIECEXQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H42N3P/c1-5-27(6-2)19-21-29(22-20-28(7-3)8-4)23-24-30(25-15-11-9-12-16-25)26-17-13-10-14-18-26/h9-18H,5-8,19-24H2,1-4H3.
What are the key properties of N'-[2-(diethylamino)ethyl]-N'-(2-diphenylphosphanylethyl)-N,N-diethylethane-1,2-diamine?
N'-[2-(diethylamino)ethyl]-N'-(2-diphenylphosphanylethyl)-N,N-diethylethane-1,2-diamine has a molecular weight of 427.62 g/mol, XLogP of 4.10, 15 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(diethylamino)ethyl]-N'-(2-diphenylphosphanylethyl)-N,N-diethylethane-1,2-diamine is sourced from PubChem (CID 54573019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).