C20H28N2Si2 — CID 54573208
1,2-diphenyl-N,N'-bis(trimethylsilyl)ethane-1,2-diimine (PubChem CID 54573208) has the molecular formula C20H28N2Si2 and a molecular weight of 352.63 g/mol. Its IUPAC name is 1,2-diphenyl-N,N'-bis(trimethylsilyl)ethane-1,2-diimine.
| Compound Name | 1,2-diphenyl-N,N'-bis(trimethylsilyl)ethane-1,2-diimine |
|---|---|
| PubChem CID | 54573208 |
| Molecular Formula | C20H28N2Si2 |
| Molecular Weight | 352.63 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1,2-diphenyl-N,N'-bis(trimethylsilyl)ethane-1,2-diimine |
| SMILES | C[Si](C)(C)N=C(C(=N[Si](C)(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H28N2Si2/c1-23(2,3)21-19(17-13-9-7-10-14-17)20(22-24(4,5)6)18-15-11-8-12-16-18/h7-16H,1-6H3 |
| InChIKey | ZYTSMJGBIHQFHD-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.63 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|