C7H7Cl2F3O2 — CID 54573608
cis-(1S,3R)-2,2-dichloro-3-methyl-3-(2,2,2-trifluoroethyl)cyclopropane-1-carboxylic acid (PubChem CID 54573608) has the molecular formula C7H7Cl2F3O2 and a molecular weight of 251.03 g/mol. Its IUPAC name is cis-(1S,3R)-2,2-dichloro-3-methyl-3-(2,2,2-trifluoroethyl)cyclopropane-1-carboxylic acid.
| Compound Name | cis-(1S,3R)-2,2-dichloro-3-methyl-3-(2,2,2-trifluoroethyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 54573608 |
| Molecular Formula | C7H7Cl2F3O2 |
| Molecular Weight | 251.03 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | cis-(1S,3R)-2,2-dichloro-3-methyl-3-(2,2,2-trifluoroethyl)cyclopropane-1-carboxylic acid |
| SMILES | C[C@@]1(CC(F)(F)F)[C@@H](C(=O)O)C1(Cl)Cl |
| InChI | InChI=1S/C7H7Cl2F3O2/c1-5(2-6(10,11)12)3(4(13)14)7(5,8)9/h3H,2H2,1H3,(H,13,14)/t3-,5-/m1/s1 |
| InChIKey | ZZANFJKVFCHTMD-NQXXGFSBSA-N |
| XLogP | 2.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.03 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|