C6H8F7N — CID 54573643
N-ethyl-2,2,3,3,4,4,4-heptafluorobutan-1-amine (PubChem CID 54573643) has the molecular formula C6H8F7N and a molecular weight of 227.12 g/mol. Its IUPAC name is N-ethyl-2,2,3,3,4,4,4-heptafluorobutan-1-amine.
| Compound Name | N-ethyl-2,2,3,3,4,4,4-heptafluorobutan-1-amine |
|---|---|
| PubChem CID | 54573643 |
| Molecular Formula | C6H8F7N |
| Molecular Weight | 227.12 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | N-ethyl-2,2,3,3,4,4,4-heptafluorobutan-1-amine |
| SMILES | CCNCC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H8F7N/c1-2-14-3-4(7,8)5(9,10)6(11,12)13/h14H,2-3H2,1H3 |
| InChIKey | KMIMRUFRWCAQJQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.12 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|