C40H40N2O2 — CID 54573953
2,5-bis[(4-butan-2-ylphenyl)methyl]-1,4-diphenylpyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 54573953) has the molecular formula C40H40N2O2 and a molecular weight of 580.77 g/mol. Its IUPAC name is 2,5-bis[(4-butan-2-ylphenyl)methyl]-1,4-diphenylpyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2,5-bis[(4-butan-2-ylphenyl)methyl]-1,4-diphenylpyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 54573953 |
| Molecular Formula | C40H40N2O2 |
| Molecular Weight | 580.77 g/mol |
| Exact Mass | 580.31 |
| IUPAC Name | 2,5-bis[(4-butan-2-ylphenyl)methyl]-1,4-diphenylpyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCC(C)c1ccc(CN2C(=O)C3=C(c4ccccc4)N(Cc4ccc(C(C)CC)cc4)C(=O)C3=C2c2ccccc2)cc1 |
| InChI | InChI=1S/C40H40N2O2/c1-5-27(3)31-21-17-29(18-22-31)25-41-37(33-13-9-7-10-14-33)35-36(39(41)43)38(34-15-11-8-12-16-34)42(40(35)44)26-30-19-23-32(24-20-30)28(4)6-2/h7-24,27-28H,5-6,25-26H2,1-4H3 |
| InChIKey | OYFAYUPSKDNNJR-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.77 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|