About 4-(5-butyl-4-methyl-1,3-dioxan-2-yl)benzonitrile
4-(5-butyl-4-methyl-1,3-dioxan-2-yl)benzonitrile (PubChem CID 54574060) has the molecular formula C16H21NO2
and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-(5-butyl-4-methyl-1,3-dioxan-2-yl)benzonitrile.
Molecular Properties
| Compound Name | 4-(5-butyl-4-methyl-1,3-dioxan-2-yl)benzonitrile |
| PubChem CID | 54574060 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 4-(5-butyl-4-methyl-1,3-dioxan-2-yl)benzonitrile |
| SMILES | CCCCC1COC(c2ccc(C#N)cc2)OC1C |
| InChI | InChI=1S/C16H21NO2/c1-3-4-5-15-11-18-16(19-12(15)2)14-8-6-13(10-17)7-9-14/h6-9,12,15-16H,3-5,11H2,1-2H3 |
| InChIKey | ZZICPOQRZCEBCP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(5-butyl-4-methyl-1,3-dioxan-2-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-butyl-4-methyl-1,3-dioxan-2-yl)benzonitrile?
The IUPAC name of 4-(5-butyl-4-methyl-1,3-dioxan-2-yl)benzonitrile (CID 54574060) is 4-(5-butyl-4-methyl-1,3-dioxan-2-yl)benzonitrile.
What is the SMILES notation for 4-(5-butyl-4-methyl-1,3-dioxan-2-yl)benzonitrile?
The canonical SMILES for 4-(5-butyl-4-methyl-1,3-dioxan-2-yl)benzonitrile is CCCCC1COC(c2ccc(C#N)cc2)OC1C.
What is the InChIKey of 4-(5-butyl-4-methyl-1,3-dioxan-2-yl)benzonitrile?
The InChIKey is ZZICPOQRZCEBCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NO2/c1-3-4-5-15-11-18-16(19-12(15)2)14-8-6-13(10-17)7-9-14/h6-9,12,15-16H,3-5,11H2,1-2H3.
What are the key properties of 4-(5-butyl-4-methyl-1,3-dioxan-2-yl)benzonitrile?
4-(5-butyl-4-methyl-1,3-dioxan-2-yl)benzonitrile has a molecular weight of 259.35 g/mol, XLogP of 3.80, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-butyl-4-methyl-1,3-dioxan-2-yl)benzonitrile is sourced from PubChem (CID 54574060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).