About pentafluoro-[4-[2-(4-octoxycyclohexyl)ethyl]phenyl]-λ6-sulfane
pentafluoro-[4-[2-(4-octoxycyclohexyl)ethyl]phenyl]-λ6-sulfane (PubChem CID 54574274) has the molecular formula C22H35F5OS
and a molecular weight of 442.58 g/mol. Its IUPAC name is pentafluoro-[4-[2-(4-octoxycyclohexyl)ethyl]phenyl]-λ6-sulfane.
Molecular Properties
| Compound Name | pentafluoro-[4-[2-(4-octoxycyclohexyl)ethyl]phenyl]-λ6-sulfane |
| PubChem CID | 54574274 |
| Molecular Formula | C22H35F5OS |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | pentafluoro-[4-[2-(4-octoxycyclohexyl)ethyl]phenyl]-λ6-sulfane |
| SMILES | CCCCCCCCOC1CCC(CCc2ccc(S(F)(F)(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H35F5OS/c1-2-3-4-5-6-7-18-28-21-14-10-19(11-15-21)8-9-20-12-16-22(17-13-20)29(23,24,25,26)27/h12-13,16-17,19,21H,2-11,14-15,18H2,1H3 |
| InChIKey | ZZLKWNDCBKKPNL-UHFFFAOYSA-N |
| XLogP | 9.21 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 9.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pentafluoro-[4-[2-(4-octoxycyclohexyl)ethyl]phenyl]-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentafluoro-[4-[2-(4-octoxycyclohexyl)ethyl]phenyl]-λ6-sulfane?
The IUPAC name of pentafluoro-[4-[2-(4-octoxycyclohexyl)ethyl]phenyl]-λ6-sulfane (CID 54574274) is pentafluoro-[4-[2-(4-octoxycyclohexyl)ethyl]phenyl]-λ6-sulfane.
What is the SMILES notation for pentafluoro-[4-[2-(4-octoxycyclohexyl)ethyl]phenyl]-λ6-sulfane?
The canonical SMILES for pentafluoro-[4-[2-(4-octoxycyclohexyl)ethyl]phenyl]-λ6-sulfane is CCCCCCCCOC1CCC(CCc2ccc(S(F)(F)(F)(F)F)cc2)CC1.
What is the InChIKey of pentafluoro-[4-[2-(4-octoxycyclohexyl)ethyl]phenyl]-λ6-sulfane?
The InChIKey is ZZLKWNDCBKKPNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35F5OS/c1-2-3-4-5-6-7-18-28-21-14-10-19(11-15-21)8-9-20-12-16-22(17-13-20)29(23,24,25,26)27/h12-13,16-17,19,21H,2-11,14-15,18H2,1H3.
What are the key properties of pentafluoro-[4-[2-(4-octoxycyclohexyl)ethyl]phenyl]-λ6-sulfane?
pentafluoro-[4-[2-(4-octoxycyclohexyl)ethyl]phenyl]-λ6-sulfane has a molecular weight of 442.58 g/mol, XLogP of 9.21, 12 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for pentafluoro-[4-[2-(4-octoxycyclohexyl)ethyl]phenyl]-λ6-sulfane is sourced from PubChem (CID 54574274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).