C20H14 — CID 54574596
1-[2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)ethenyl]naphthalene (PubChem CID 54574596) has the molecular formula C20H14 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-[2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)ethenyl]naphthalene.
| Compound Name | 1-[2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)ethenyl]naphthalene |
|---|---|
| PubChem CID | 54574596 |
| Molecular Formula | C20H14 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-[2-(3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenyl)ethenyl]naphthalene |
| SMILES | C(=Cc1cccc2ccccc12)c1ccc2c(c1)C=C2 |
| InChI | InChI=1S/C20H14/c1-2-7-20-17(4-1)5-3-6-18(20)11-9-15-8-10-16-12-13-19(16)14-15/h1-14H |
| InChIKey | ZZRCVWPFHOQPQB-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|