About N-ethyl-N-(3-ethylpentan-2-yl)-2,4-dimethylpentanamide
N-ethyl-N-(3-ethylpentan-2-yl)-2,4-dimethylpentanamide (PubChem CID 54574815) has the molecular formula C16H33NO
and a molecular weight of 255.45 g/mol. Its IUPAC name is N-ethyl-N-(3-ethylpentan-2-yl)-2,4-dimethylpentanamide.
Molecular Properties
| Compound Name | N-ethyl-N-(3-ethylpentan-2-yl)-2,4-dimethylpentanamide |
| PubChem CID | 54574815 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | N-ethyl-N-(3-ethylpentan-2-yl)-2,4-dimethylpentanamide |
| SMILES | CCC(CC)C(C)N(CC)C(=O)C(C)CC(C)C |
| InChI | InChI=1S/C16H33NO/c1-8-15(9-2)14(7)17(10-3)16(18)13(6)11-12(4)5/h12-15H,8-11H2,1-7H3 |
| InChIKey | ZZVFMVRFVZTOKA-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-N-(3-ethylpentan-2-yl)-2,4-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-(3-ethylpentan-2-yl)-2,4-dimethylpentanamide?
The IUPAC name of N-ethyl-N-(3-ethylpentan-2-yl)-2,4-dimethylpentanamide (CID 54574815) is N-ethyl-N-(3-ethylpentan-2-yl)-2,4-dimethylpentanamide.
What is the SMILES notation for N-ethyl-N-(3-ethylpentan-2-yl)-2,4-dimethylpentanamide?
The canonical SMILES for N-ethyl-N-(3-ethylpentan-2-yl)-2,4-dimethylpentanamide is CCC(CC)C(C)N(CC)C(=O)C(C)CC(C)C.
What is the InChIKey of N-ethyl-N-(3-ethylpentan-2-yl)-2,4-dimethylpentanamide?
The InChIKey is ZZVFMVRFVZTOKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO/c1-8-15(9-2)14(7)17(10-3)16(18)13(6)11-12(4)5/h12-15H,8-11H2,1-7H3.
What are the key properties of N-ethyl-N-(3-ethylpentan-2-yl)-2,4-dimethylpentanamide?
N-ethyl-N-(3-ethylpentan-2-yl)-2,4-dimethylpentanamide has a molecular weight of 255.45 g/mol, XLogP of 4.34, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-(3-ethylpentan-2-yl)-2,4-dimethylpentanamide is sourced from PubChem (CID 54574815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).