C27H35N9O4S2 — CID 54575107
N-hydroxy-4-[4-[2-(1H-indazol-4-yl)-6-[(4-methylsulfonylpiperazin-1-yl)methyl]thieno[3,2-d]pyrimidin-4-yl]piperazin-1-yl]butanamide (PubChem CID 54575107) has the molecular formula C27H35N9O4S2 and a molecular weight of 613.77 g/mol. Its IUPAC name is N-hydroxy-4-[4-[2-(1H-indazol-4-yl)-6-[(4-methylsulfonylpiperazin-1-yl)methyl]thieno[3,2-d]pyrimidin-4-yl]piperazin-1-yl]butanamide.
| Compound Name | N-hydroxy-4-[4-[2-(1H-indazol-4-yl)-6-[(4-methylsulfonylpiperazin-1-yl)methyl]thieno[3,2-d]pyrimidin-4-yl]piperazin-1-yl]butanamide |
|---|---|
| PubChem CID | 54575107 |
| Molecular Formula | C27H35N9O4S2 |
| Molecular Weight | 613.77 g/mol |
| Exact Mass | 613.23 |
| IUPAC Name | N-hydroxy-4-[4-[2-(1H-indazol-4-yl)-6-[(4-methylsulfonylpiperazin-1-yl)methyl]thieno[3,2-d]pyrimidin-4-yl]piperazin-1-yl]butanamide |
| SMILES | CS(=O)(=O)N1CCN(Cc2cc3nc(-c4cccc5[nH]ncc45)nc(N4CCN(CCCC(=O)NO)CC4)c3s2)CC1 |
| InChI | InChI=1S/C27H35N9O4S2/c1-42(39,40)36-14-10-34(11-15-36)18-19-16-23-25(41-19)27(35-12-8-33(9-13-35)7-3-6-24(37)32-38)30-26(29-23)20-4-2-5-22-21(20)17-28-31-22/h2,4-5,16-17,38H,3,6-15,18H2,1H3,(H,28,31)(H,32,37) |
| InChIKey | PWIUNKQDFKNOHO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 150.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.77 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|