C17H19N3O2 — CID 54575783
4-(6-methyl-12,14-dioxa-5,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11(15)-hexaen-8-yl)butan-1-amine (PubChem CID 54575783) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 4-(6-methyl-12,14-dioxa-5,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11(15)-hexaen-8-yl)butan-1-amine.
| Compound Name | 4-(6-methyl-12,14-dioxa-5,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11(15)-hexaen-8-yl)butan-1-amine |
|---|---|
| PubChem CID | 54575783 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 4-(6-methyl-12,14-dioxa-5,8-diazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(16),2(7),3,5,9,11(15)-hexaen-8-yl)butan-1-amine |
| SMILES | Cc1nccc2c3cc4c(cc3n(CCCCN)c12)OCO4 |
| InChI | InChI=1S/C17H19N3O2/c1-11-17-12(4-6-19-11)13-8-15-16(22-10-21-15)9-14(13)20(17)7-3-2-5-18/h4,6,8-9H,2-3,5,7,10,18H2,1H3 |
| InChIKey | LGWCTYRTABVWOH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|