C20H20F5N5O6 — CID 54575848
2-[4-[3,5-difluoro-4-(trifluoromethoxy)phenoxy]piperidin-1-yl]-N-[(5S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-5-yl]acetamide (PubChem CID 54575848) has the molecular formula C20H20F5N5O6 and a molecular weight of 521.40 g/mol. Its IUPAC name is 2-[4-[3,5-difluoro-4-(trifluoromethoxy)phenoxy]piperidin-1-yl]-N-[(5S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-5-yl]acetamide.
| Compound Name | 2-[4-[3,5-difluoro-4-(trifluoromethoxy)phenoxy]piperidin-1-yl]-N-[(5S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-5-yl]acetamide |
|---|---|
| PubChem CID | 54575848 |
| Molecular Formula | C20H20F5N5O6 |
| Molecular Weight | 521.40 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 2-[4-[3,5-difluoro-4-(trifluoromethoxy)phenoxy]piperidin-1-yl]-N-[(5S)-2-nitro-6,7-dihydro-5H-imidazo[2,1-b][1,3]oxazin-5-yl]acetamide |
| SMILES | O=C(CN1CCC(Oc2cc(F)c(OC(F)(F)F)c(F)c2)CC1)N[C@@H]1CCOc2nc([N+](=O)[O-])cn21 |
| InChI | InChI=1S/C20H20F5N5O6/c21-13-7-12(8-14(22)18(13)36-20(23,24)25)35-11-1-4-28(5-2-11)10-17(31)26-15-3-6-34-19-27-16(30(32)33)9-29(15)19/h7-9,11,15H,1-6,10H2,(H,26,31)/t15-/m0/s1 |
| InChIKey | HEPHWWOVFWRYTN-HNNXBMFYSA-N |
| XLogP | 2.91 |
| TPSA | 120.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|