About 1-[[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-6,7-dimethoxyisoquinoline;oxalic acid
1-[[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-6,7-dimethoxyisoquinoline;oxalic acid (PubChem CID 54576316) has the molecular formula C23H24FNO8
and a molecular weight of 461.44 g/mol. Its IUPAC name is 1-[[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-6,7-dimethoxyisoquinoline;oxalic acid.
Molecular Properties
| Compound Name | 1-[[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-6,7-dimethoxyisoquinoline;oxalic acid |
| PubChem CID | 54576316 |
| Molecular Formula | C23H24FNO8 |
| Molecular Weight | 461.44 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | 1-[[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-6,7-dimethoxyisoquinoline;oxalic acid |
| SMILES | COc1cc2ccnc(Cc3ccc(OCCF)c(OC)c3)c2cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H22FNO4.C2H2O4/c1-24-19-11-14(4-5-18(19)27-9-7-22)10-17-16-13-21(26-3)20(25-2)12-15(16)6-8-23-17;3-1(4)2(5)6/h4-6,8,11-13H,7,9-10H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | DBRVTFPQWYWJMY-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 124.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-6,7-dimethoxyisoquinoline;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-6,7-dimethoxyisoquinoline;oxalic acid?
The IUPAC name of 1-[[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-6,7-dimethoxyisoquinoline;oxalic acid (CID 54576316) is 1-[[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-6,7-dimethoxyisoquinoline;oxalic acid.
What is the SMILES notation for 1-[[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-6,7-dimethoxyisoquinoline;oxalic acid?
The canonical SMILES for 1-[[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-6,7-dimethoxyisoquinoline;oxalic acid is COc1cc2ccnc(Cc3ccc(OCCF)c(OC)c3)c2cc1OC.O=C(O)C(=O)O.
What is the InChIKey of 1-[[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-6,7-dimethoxyisoquinoline;oxalic acid?
The InChIKey is DBRVTFPQWYWJMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22FNO4.C2H2O4/c1-24-19-11-14(4-5-18(19)27-9-7-22)10-17-16-13-21(26-3)20(25-2)12-15(16)6-8-23-17;3-1(4)2(5)6/h4-6,8,11-13H,7,9-10H2,1-3H3;(H,3,4)(H,5,6).
What are the key properties of 1-[[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-6,7-dimethoxyisoquinoline;oxalic acid?
1-[[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-6,7-dimethoxyisoquinoline;oxalic acid has a molecular weight of 461.44 g/mol, XLogP of 3.36, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(2-fluoroethoxy)-3-methoxyphenyl]methyl]-6,7-dimethoxyisoquinoline;oxalic acid is sourced from PubChem (CID 54576316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).