About 5-[3,4-dimethoxy-2-(2-methylpropoxy)phenyl]-2,3-dihydroinden-1-one
5-[3,4-dimethoxy-2-(2-methylpropoxy)phenyl]-2,3-dihydroinden-1-one (PubChem CID 54577161) has the molecular formula C21H24O4
and a molecular weight of 340.42 g/mol. Its IUPAC name is 5-[3,4-dimethoxy-2-(2-methylpropoxy)phenyl]-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 5-[3,4-dimethoxy-2-(2-methylpropoxy)phenyl]-2,3-dihydroinden-1-one |
| PubChem CID | 54577161 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 5-[3,4-dimethoxy-2-(2-methylpropoxy)phenyl]-2,3-dihydroinden-1-one |
| SMILES | COc1ccc(-c2ccc3c(c2)CCC3=O)c(OCC(C)C)c1OC |
| InChI | InChI=1S/C21H24O4/c1-13(2)12-25-20-17(8-10-19(23-3)21(20)24-4)15-5-7-16-14(11-15)6-9-18(16)22/h5,7-8,10-11,13H,6,9,12H2,1-4H3 |
| InChIKey | XEQVDBSBGWUHFW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[3,4-dimethoxy-2-(2-methylpropoxy)phenyl]-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,4-dimethoxy-2-(2-methylpropoxy)phenyl]-2,3-dihydroinden-1-one?
The IUPAC name of 5-[3,4-dimethoxy-2-(2-methylpropoxy)phenyl]-2,3-dihydroinden-1-one (CID 54577161) is 5-[3,4-dimethoxy-2-(2-methylpropoxy)phenyl]-2,3-dihydroinden-1-one.
What is the SMILES notation for 5-[3,4-dimethoxy-2-(2-methylpropoxy)phenyl]-2,3-dihydroinden-1-one?
The canonical SMILES for 5-[3,4-dimethoxy-2-(2-methylpropoxy)phenyl]-2,3-dihydroinden-1-one is COc1ccc(-c2ccc3c(c2)CCC3=O)c(OCC(C)C)c1OC.
What is the InChIKey of 5-[3,4-dimethoxy-2-(2-methylpropoxy)phenyl]-2,3-dihydroinden-1-one?
The InChIKey is XEQVDBSBGWUHFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24O4/c1-13(2)12-25-20-17(8-10-19(23-3)21(20)24-4)15-5-7-16-14(11-15)6-9-18(16)22/h5,7-8,10-11,13H,6,9,12H2,1-4H3.
What are the key properties of 5-[3,4-dimethoxy-2-(2-methylpropoxy)phenyl]-2,3-dihydroinden-1-one?
5-[3,4-dimethoxy-2-(2-methylpropoxy)phenyl]-2,3-dihydroinden-1-one has a molecular weight of 340.42 g/mol, XLogP of 4.53, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,4-dimethoxy-2-(2-methylpropoxy)phenyl]-2,3-dihydroinden-1-one is sourced from PubChem (CID 54577161), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).