About 1-(4-chloro-1,3,5-triazin-2-yl)piperidine-4-carboxamide
1-(4-chloro-1,3,5-triazin-2-yl)piperidine-4-carboxamide (PubChem CID 54577220) has the molecular formula C9H12ClN5O
and a molecular weight of 241.68 g/mol. Its IUPAC name is 1-(4-chloro-1,3,5-triazin-2-yl)piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-(4-chloro-1,3,5-triazin-2-yl)piperidine-4-carboxamide |
| PubChem CID | 54577220 |
| Molecular Formula | C9H12ClN5O |
| Molecular Weight | 241.68 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 1-(4-chloro-1,3,5-triazin-2-yl)piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(c2ncnc(Cl)n2)CC1 |
| InChI | InChI=1S/C9H12ClN5O/c10-8-12-5-13-9(14-8)15-3-1-6(2-4-15)7(11)16/h5-6H,1-4H2,(H2,11,16) |
| InChIKey | YGKIYFZUDUNMRY-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.68 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-chloro-1,3,5-triazin-2-yl)piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chloro-1,3,5-triazin-2-yl)piperidine-4-carboxamide?
The IUPAC name of 1-(4-chloro-1,3,5-triazin-2-yl)piperidine-4-carboxamide (CID 54577220) is 1-(4-chloro-1,3,5-triazin-2-yl)piperidine-4-carboxamide.
What is the SMILES notation for 1-(4-chloro-1,3,5-triazin-2-yl)piperidine-4-carboxamide?
The canonical SMILES for 1-(4-chloro-1,3,5-triazin-2-yl)piperidine-4-carboxamide is NC(=O)C1CCN(c2ncnc(Cl)n2)CC1.
What is the InChIKey of 1-(4-chloro-1,3,5-triazin-2-yl)piperidine-4-carboxamide?
The InChIKey is YGKIYFZUDUNMRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClN5O/c10-8-12-5-13-9(14-8)15-3-1-6(2-4-15)7(11)16/h5-6H,1-4H2,(H2,11,16).
What are the key properties of 1-(4-chloro-1,3,5-triazin-2-yl)piperidine-4-carboxamide?
1-(4-chloro-1,3,5-triazin-2-yl)piperidine-4-carboxamide has a molecular weight of 241.68 g/mol, XLogP of 0.23, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chloro-1,3,5-triazin-2-yl)piperidine-4-carboxamide is sourced from PubChem (CID 54577220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).