C32H39Cl2N5O — CID 54577234
N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-5-methyl-1,2-diphenylimidazole-4-carboxamide;dihydrochloride (PubChem CID 54577234) has the molecular formula C32H39Cl2N5O and a molecular weight of 580.60 g/mol. Its IUPAC name is N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-5-methyl-1,2-diphenylimidazole-4-carboxamide;dihydrochloride.
| Compound Name | N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-5-methyl-1,2-diphenylimidazole-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 54577234 |
| Molecular Formula | C32H39Cl2N5O |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 579.25 |
| IUPAC Name | N-[3-[4-(2,3-dimethylphenyl)piperazin-1-yl]propyl]-5-methyl-1,2-diphenylimidazole-4-carboxamide;dihydrochloride |
| SMILES | Cc1cccc(N2CCN(CCCNC(=O)c3nc(-c4ccccc4)n(-c4ccccc4)c3C)CC2)c1C.Cl.Cl |
| InChI | InChI=1S/C32H37N5O.2ClH/c1-24-12-10-17-29(25(24)2)36-22-20-35(21-23-36)19-11-18-33-32(38)30-26(3)37(28-15-8-5-9-16-28)31(34-30)27-13-6-4-7-14-27;;/h4-10,12-17H,11,18-23H2,1-3H3,(H,33,38);2*1H |
| InChIKey | GQROKINCBADIKJ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|