C26H21F3N4O3 — CID 54577458
N-methyl-3-[1-(4-nitrophenyl)-5-[4-[4-(trifluoromethyl)phenyl]phenyl]pyrazol-3-yl]propanamide (PubChem CID 54577458) has the molecular formula C26H21F3N4O3 and a molecular weight of 494.47 g/mol. Its IUPAC name is N-methyl-3-[1-(4-nitrophenyl)-5-[4-[4-(trifluoromethyl)phenyl]phenyl]pyrazol-3-yl]propanamide.
| Compound Name | N-methyl-3-[1-(4-nitrophenyl)-5-[4-[4-(trifluoromethyl)phenyl]phenyl]pyrazol-3-yl]propanamide |
|---|---|
| PubChem CID | 54577458 |
| Molecular Formula | C26H21F3N4O3 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.16 |
| IUPAC Name | N-methyl-3-[1-(4-nitrophenyl)-5-[4-[4-(trifluoromethyl)phenyl]phenyl]pyrazol-3-yl]propanamide |
| SMILES | CNC(=O)CCc1cc(-c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)n(-c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C26H21F3N4O3/c1-30-25(34)15-10-21-16-24(32(31-21)22-11-13-23(14-12-22)33(35)36)19-4-2-17(3-5-19)18-6-8-20(9-7-18)26(27,28)29/h2-9,11-14,16H,10,15H2,1H3,(H,30,34) |
| InChIKey | KUJLAPHFSKFJNE-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|