C34H61NO7Si2 — CID 54577486
(4R)-4-benzyl-3-[(2R,3S,5R,6R)-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-5-methoxy-2,6-dimethylnonanoyl]-1,3-oxazolidin-2-one (PubChem CID 54577486) has the molecular formula C34H61NO7Si2 and a molecular weight of 652.03 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3S,5R,6R)-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-5-methoxy-2,6-dimethylnonanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3S,5R,6R)-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-5-methoxy-2,6-dimethylnonanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 54577486 |
| Molecular Formula | C34H61NO7Si2 |
| Molecular Weight | 652.03 g/mol |
| Exact Mass | 651.40 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3S,5R,6R)-6,9-bis[[tert-butyl(dimethyl)silyl]oxy]-3-hydroxy-5-methoxy-2,6-dimethylnonanoyl]-1,3-oxazolidin-2-one |
| SMILES | CO[C@H](C[C@H](O)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)[C@@](C)(CCCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H61NO7Si2/c1-25(30(37)35-27(24-40-31(35)38)22-26-18-15-14-16-19-26)28(36)23-29(39-9)34(8,42-44(12,13)33(5,6)7)20-17-21-41-43(10,11)32(2,3)4/h14-16,18-19,25,27-29,36H,17,20-24H2,1-13H3/t25-,27-,28+,29-,34-/m1/s1 |
| InChIKey | NRGBZGHETPLZSP-AWKMMQKESA-N |
| XLogP | 7.56 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.03 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|