C41H29BrN2O — CID 54577494
2-bromo-N-(4-methylphenyl)-5,6,7,8-tetraphenylquinoline-4-carboxamide (PubChem CID 54577494) has the molecular formula C41H29BrN2O and a molecular weight of 645.60 g/mol. Its IUPAC name is 2-bromo-N-(4-methylphenyl)-5,6,7,8-tetraphenylquinoline-4-carboxamide.
| Compound Name | 2-bromo-N-(4-methylphenyl)-5,6,7,8-tetraphenylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 54577494 |
| Molecular Formula | C41H29BrN2O |
| Molecular Weight | 645.60 g/mol |
| Exact Mass | 644.15 |
| IUPAC Name | 2-bromo-N-(4-methylphenyl)-5,6,7,8-tetraphenylquinoline-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc(Br)nc3c(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)c(-c4ccccc4)c23)cc1 |
| InChI | InChI=1S/C41H29BrN2O/c1-27-22-24-32(25-23-27)43-41(45)33-26-34(42)44-40-38(31-20-12-5-13-21-31)36(29-16-8-3-9-17-29)35(28-14-6-2-7-15-28)37(39(33)40)30-18-10-4-11-19-30/h2-26H,1H3,(H,43,45) |
| InChIKey | WOBNXQWRQUYAAR-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.60 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|