C22H21ClN6O — CID 54577505
3-[4-(8-chloro-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)cyclohexyl]-[1,2]oxazolo[4,5-b]pyridine (PubChem CID 54577505) has the molecular formula C22H21ClN6O and a molecular weight of 420.90 g/mol. Its IUPAC name is 3-[4-(8-chloro-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)cyclohexyl]-[1,2]oxazolo[4,5-b]pyridine.
| Compound Name | 3-[4-(8-chloro-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)cyclohexyl]-[1,2]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 54577505 |
| Molecular Formula | C22H21ClN6O |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 3-[4-(8-chloro-5,6-dihydro-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-1-yl)cyclohexyl]-[1,2]oxazolo[4,5-b]pyridine |
| SMILES | Clc1ccc2c(c1)CNCc1nnc(C3CCC(c4noc5cccnc45)CC3)n1-2 |
| InChI | InChI=1S/C22H21ClN6O/c23-16-7-8-17-15(10-16)11-24-12-19-26-27-22(29(17)19)14-5-3-13(4-6-14)20-21-18(30-28-20)2-1-9-25-21/h1-2,7-10,13-14,24H,3-6,11-12H2 |
| InChIKey | DHEOGVSNYZXFOX-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 81.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |