C26H27NO5 — CID 54577830
(3R,4S)-4-(4-ethoxyphenyl)-3-phenyl-1-(3,4,5-trimethoxyphenyl)azetidin-2-one (PubChem CID 54577830) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is (3R,4S)-4-(4-ethoxyphenyl)-3-phenyl-1-(3,4,5-trimethoxyphenyl)azetidin-2-one.
| Compound Name | (3R,4S)-4-(4-ethoxyphenyl)-3-phenyl-1-(3,4,5-trimethoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 54577830 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (3R,4S)-4-(4-ethoxyphenyl)-3-phenyl-1-(3,4,5-trimethoxyphenyl)azetidin-2-one |
| SMILES | CCOc1ccc([C@@H]2[C@@H](c3ccccc3)C(=O)N2c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C26H27NO5/c1-5-32-20-13-11-18(12-14-20)24-23(17-9-7-6-8-10-17)26(28)27(24)19-15-21(29-2)25(31-4)22(16-19)30-3/h6-16,23-24H,5H2,1-4H3/t23-,24-/m1/s1 |
| InChIKey | UXGMWOMOIXQARM-DNQXCXABSA-N |
| XLogP | 4.98 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |