C24H27N7O2S — CID 54577895
N-[2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]methanesulfonamide (PubChem CID 54577895) has the molecular formula C24H27N7O2S and a molecular weight of 477.59 g/mol. Its IUPAC name is N-[2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]methanesulfonamide.
| Compound Name | N-[2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 54577895 |
| Molecular Formula | C24H27N7O2S |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | N-[2-[2-[4-(4-methylpiperazin-1-yl)anilino]pyrrolo[2,1-f][1,2,4]triazin-7-yl]phenyl]methanesulfonamide |
| SMILES | CN1CCN(c2ccc(Nc3ncc4ccc(-c5ccccc5NS(C)(=O)=O)n4n3)cc2)CC1 |
| InChI | InChI=1S/C24H27N7O2S/c1-29-13-15-30(16-14-29)19-9-7-18(8-10-19)26-24-25-17-20-11-12-23(31(20)27-24)21-5-3-4-6-22(21)28-34(2,32)33/h3-12,17,28H,13-16H2,1-2H3,(H,26,27) |
| InChIKey | JUNCBMUICVPMDN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 94.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|